| Year |
Citation |
Score |
| 2002 |
Templeton LK, Templeton DH, Bartlett N, Seppelt K. Crystal And Molecular Structure Of Uranium Hexakis(Oxopentafluorotellurate), U(Otef5)6 Cheminform. 8. DOI: 10.1002/Chin.197704004 |
0.529 |
|
| 1999 |
Templeton DH. Faster calculation of the full matrix for least-squares refinement. Acta Crystallographica. Section a, Foundations of Crystallography. 55: 695-699. PMID 10927280 DOI: 10.1107/S0108767398018327 |
0.318 |
|
| 1997 |
Templeton DH, Templeton LK. Polarized dispersion of X-rays in pyrite. Acta Crystallographica. Section a, Foundations of Crystallography. 53: 352-5. PMID 9175260 DOI: 10.1107/S0108767397000330 |
0.328 |
|
| 1992 |
Templeton DH, Templeton LK. Polarized dispersion, glide-rule-forbidden reflections and phase determination in barium bromate monohydrate. Acta Crystallographica. Section a, Foundations of Crystallography. 48: 746-51. PMID 1445682 DOI: 10.1107/S0108767392003234 |
0.411 |
|
| 1991 |
Templeton DH, Templeton LK. Phase determination by polarized dispersion in vanadyl sulfate pentahydrate. Acta Crystallographica. Section a, Foundations of Crystallography. 47: 414-20. PMID 1910635 DOI: 10.1107/S010876739100212X |
0.336 |
|
| 1990 |
Templeton DH, Ruben HW, Zalkin A. Entropy and crystal structure of hydrates of disodium hydrogen phosphate Journal of Physical Chemistry. 94: 7830-7834. DOI: 10.1021/J100383A017 |
0.379 |
|
| 1989 |
Templeton LK, Templeton DH. Structure of rubidium hydrogen (+)‐tartrate Acta Crystallographica Section C. 45: 675-676. DOI: 10.1107/S0108270188013058 |
0.334 |
|
| 1988 |
Templeton LK, Templeton DH. Biaxial tensors for anomalous scattering of X-rays in selenolanthionine. Acta Crystallographica. Section a, Foundations of Crystallography. 44: 1045-51. PMID 3271115 DOI: 10.1107/S0108767388007810 |
0.312 |
|
| 1987 |
Žemva B, Jesih A, Templeton DH, Zalkin A, Cheetham AK, Bartlett N. Phases in the system XeF2/XeF5AsF6 and structural and vibrational evidence for the following ionization pathway: XeF2 → XeF+ + F- Journal of the American Chemical Society. 109: 7420-7427. DOI: 10.1021/Ja00258A028 |
0.304 |
|
| 1985 |
Chapuis G, Templeton DH, Templeton LK. Solving crystal structures using several wavelengths from conventional sources. Anomalous scattering by holmium Acta Crystallographica Section A. 41: 274-278. DOI: 10.1107/S0108767385000575 |
0.383 |
|
| 1985 |
Zalkin A, Templeton DH. Refinement of the trigonal crystal structure of lanthanum trifluoride with neutron diffraction data. Acta Crystallographica. 91-93. |
0.434 |
|
| 1983 |
Shinomoto R, Gamp E, Edelstein NM, Templeton DH, Zalkin A. Syntheses and crystal structures of the tetrakis(methyltrihydroborato) compounds of zirconium(IV), thorium(IV), uranium(IV), and neptunium(IV) Inorganic Chemistry. 22: 2351-2355. DOI: 10.1002/Chin.198347260 |
0.471 |
|
| 1982 |
Zalkin A, Templeton DH, Luke WD, Streitwieser A. Synthesis and structure of dicyclopentenouranocene, U[C8H6(CH2)3]2 Organometallics. 1: 618-622. DOI: 10.1021/Om00064A008 |
0.475 |
|
| 1982 |
Tilley TD, Andersen RA, Zalkin A, Templeton DH. Bis(pentamethylcyclopentadienyl)carboxylato and -dithiocarbamato derivatives of neodymium(III) and ytterbium(III). Crystal structure of bis(pentamethylcyclopentadienyl)(diethyldithiocarbamato)ytterbium(III) Inorganic Chemistry. 21: 2644-2647. DOI: 10.1021/Ic00137A022 |
0.468 |
|
| 1982 |
Perry DL, Zalkin A, Ruben H, Templeton DH. Synthesis, characterization, and structure of a uranyl complex with a disulfide ligand, bis(di-n-propylammonium) disulfidobis(di-n-propylthiocarbamato)dioxouranate(VI) Inorganic Chemistry. 21: 237-240. DOI: 10.1021/Ic00131A044 |
0.332 |
|
| 1982 |
TILLEY TD, ANDERSEN RA, ZALKIN A, TEMPLETON DH. ChemInform Abstract: BIS(PENTAMETHYLCYCLOPENTADIENYL)CARBOXYLATO AND -DITHIOCARBAMATO DERIVATIVES OF NEODYMIUM(III) AND YTTERBIUM(III). CRYSTAL STRUCTURE OF BIS(PENTAMETHYLCYCLOPENTADIENYL)(DIETHYLDITHIOCARBAMATO)YTTERBIUM(III) Chemischer Informationsdienst. 13. DOI: 10.1002/chin.198240263 |
0.366 |
|
| 1982 |
Tilley TD, Andersen RA, Zalkin A, Templeton DH. Bis(pentamethylcyclopentadienyl)carboxylato and -dithiocarbamato derivatives of neodymium(III) and ytterbium(III). Crystal structure of bis(pentamethylcyclopentadienyl)(diethyldithiocarbamato)ytterbium(III) Inorganic Chemistry. 21: 2644-2647. |
0.368 |
|
| 1981 |
McCullough LG, Turner HW, Andersen RA, Zalkin A, Templeton DH. Preparation and crystal structure of the 1,2-dimethoxyethane complex of bis(bis(trimethylsilyl)amido)dichlorouranium(IV) Inorganic Chemistry. 20: 2869-2871. DOI: 10.1021/Ic50223A025 |
0.439 |
|
| 1981 |
Andersen RA, Zalkin A, Templeton DH. Crystal And Molecular Structure Of Hydridotis (Bis(Trimethylsilyl)Amido]Uranium(Iv) Inorganic Chemistry. 20: 622-623. DOI: 10.1021/Ic50216A058 |
0.487 |
|
| 1981 |
Tilley TD, Zalkin A, Andersen RA, Templeton DH. Divalent lanthanide chemistry. Preparation of some four- and six-coordinate bis[(trimethylsilyl)amido] complexes of europium(II). Crystal structure of bis[bis(trimethylsilyl)amido]bis(1,2-dimethoxyethane)europium(II) Inorganic Chemistry. 20: 551-554. DOI: 10.1021/Ic50216A047 |
0.406 |
|
| 1981 |
TILLEY TD, ZALKIN A, ANDERSEN RA, TEMPLETON DH. ChemInform Abstract: DIVALENT LANTHANIDE CHEMISTRY. PREPARATION OF SOME FOUR- AND SIX-COORDINATE BIS((TRIMETHYLSILYL)AMIDO) COMPLEXES OF EUROPIUM(II). CRYSTAL STRUCTURE OF BIS(BIS(TRIMETHYLSILYL)AMIDO)BIS(1,2-DIMETHOXYETHANE)EUROPIUM(II) Chemischer Informationsdienst. 12. DOI: 10.1002/chin.198117107 |
0.309 |
|
| 1981 |
Andersen RA, Zalkin A, Templeton DH. Crystal and molecular structure of hydridotris[bis(trimethylsilyl)amido]uranium(IV) Inorganic Chemistry. 20: 622-623. |
0.473 |
|
| 1981 |
McCullough LG, Turner HW, Andersen RA, Zalkin A, Templeton DH. Preparation and crystal structure of the 1,2-dimethoxyethane complex of bis[bis(trimethylsilyl)amido]dichlorouranium(IV) Inorganic Chemistry. 20: 2869-2871. |
0.411 |
|
| 1981 |
Tilley TD, Zalkin A, Andersen RA, Templeton DH. Divalent lanthanide chemistry. Preparation of some four- and six-coordinate bis[(trimethylsilyl)amido] complexes of europium(II). Crystal structure of bis[bis(trimethylsilyl)amido]bis(1,2-dimethoxyethane)europium(II) Inorganic Chemistry. 20: 551-554. |
0.311 |
|
| 1980 |
Banks RH, Edelstein NM, Spencer B, Templeton DH, Zalkin A. Volatility and molecular structure of neptunium(IV) borohydride Journal of the American Chemical Society. 102: 620-623. DOI: 10.1021/Ja00522A029 |
0.409 |
|
| 1980 |
Tilley TD, Andersen RA, Spencer B, Ruben H, Zalkin A, Templeton DH. Divalent lanthanide chemistry. Bis (pentamethylcyclopentadienyl) europium(II) and -ytterbium(II) derivatives: crystal structure of bis (pentamethylcyclopentadienyl) (tetrahydrofuran ytterbium(II) -hemitoluene at 176 K Inorganic Chemistry. 19: 2999-3003. DOI: 10.1021/Ic50212A031 |
0.425 |
|
| 1980 |
Zalkin A, Templeton DH, Vanda CLE, Streitwieser A. Synthesis and structure of two crystalline forms of (cyclooctatetraene)thorium(IV) dichloride-bis(tetrahydrofuran) Inorganic Chemistry. 19: 2560-2563. DOI: 10.1021/Ic50211A015 |
0.342 |
|
| 1980 |
Perry DL, Ruben H, Templeton DH, Zalkin A. Structure of di-.mu.-aquo-bis(dioxobis(nitrato)uranium(VI)) diimidazole, [UO2 (NO3)2(H2O)].2C3H4N2, a water bridged dimer of uranyl nitrate Inorganic Chemistry. 19: 1067-1069. DOI: 10.1021/Ic50206A058 |
0.352 |
|
| 1980 |
Ruben H, Spencer B, Templeton DH, Zalkin A. Structure of tris(urea)dioxouranium(VI) sulfate, UO2(OC(NH2)2)3SO4 Inorganic Chemistry. 19: 776-777. DOI: 10.1021/Ic50205A040 |
0.421 |
|
| 1979 |
Templeton DH, Zalkin A, Ruben HW, Templeton LK. Anomalous scattering by cobalt and chlorine and crystal structure of (+)-tris(ethylenediamine)cobalt(III) chloride (+)-tartrate pentahydrate Acta Crystallographica Section B Structural Crystallography and Crystal Chemistry. 35: 1608-1613. DOI: 10.1107/S056774087900724X |
0.393 |
|
| 1979 |
Roush DM, Price EM, Templeton LK, Templeton DH, Heathcock CH. Synthesis, stereostructure, pyramidal inversion, and alkylation of 1-thioniabicyclo[4.4.0]decane salts Journal of the American Chemical Society. 101: 2971-2981. DOI: 10.1021/Ja00505A026 |
0.31 |
|
| 1979 |
Zalkln A, Templeton DH, Berryhill SR, Luke WD. Crystal and molecular structure of bis[π-(cyclobutenocyclooctatetraene)]uranium(IV), U[C8H6(CH2)2]2 Inorganic Chemistry. 18: 2282-2287. DOI: 10.1021/Ic50198A047 |
0.385 |
|
| 1979 |
Turner HW, Andersen RA, Zalkin A, Templeton DH. Chloro-, methyl-, and (tetrahydroborato)tris((hexamethyldisilyl)amido)thorium(IV) and uranium(IV). Crystal structure of (tetrahydroborato)tris((hexamethyldisilyl)amido)thorium(IV) Inorganic Chemistry. 18: 1221-1224. DOI: 10.1021/Ic50195A008 |
0.343 |
|
| 1979 |
Zalkin A, Ruben H, Templeton DH. Structure of pentakis(urea)dioxouranium(VI) nitrate, [UO2(OC(NH2)2)5](NO 3)2 Inorganic Chemistry. 18: 519-521. DOI: 10.1021/Ic50192A070 |
0.501 |
|
| 1979 |
Turner HW, Andersen RA, Zalkin A, Templeton DH. Chloro-, methyl-, and (tetrahydroborato)tris((hexamethyldisilyl)amido)thorium(IV) and -uranium(IV). Crystal structure of (tetrahydroborato)tris((hexamethyldisilyl)amido)thorium(IV) Inorganic Chemistry. 18: 1221-1224. |
0.384 |
|
| 1978 |
Phillips JC, Templeton DH, Templeton LK, Hodgson KO. LIII-Edge Anomalous X-ray Scattering by Cesium Measured with Synchrotron Radiation. Science (New York, N.Y.). 201: 257-9. PMID 17778657 DOI: 10.1126/Science.201.4352.257 |
0.302 |
|
| 1978 |
Andersen RA, Templeton DH, Zalkin A. SYNTHESIS AND CRYSTAL STRUCTURE OF A NEODYMIUM ISOPROPOXIDE CHLORIDE, Nd6[OCH(CH3)2]17Cl1 Inorganic Chemistry. 17: 1962-1965. DOI: 10.1021/Ic50185A053 |
0.45 |
|
| 1978 |
Zalkin A, Ward DL, Biagioni RN, Templeton DH, Bartlett N. Crystal structure of fluoroxenon(1+) hexafluoroarsenate(1-) Inorganic Chemistry. 17: 1318-1322. DOI: 10.1021/Ic50183A044 |
0.549 |
|
| 1978 |
Zalkin A, Rietz RR, Templeton DH, Edelstein NM. Preparation and crystal structure of uranium(IV) borohydride-n-propyl ether Inorganic Chemistry. 17: 661-663. DOI: 10.1021/Ic50181A030 |
0.355 |
|
| 1978 |
Rietz RR, Edelstein NM, Ruben HW, Templeton DH, Zalkin A. Preparation and crystal structure of uranium(IV) borohydride-bis(tetrahydrofuran), U(BH4)4·2OC4H8 Inorganic Chemistry. 17: 658-660. DOI: 10.1021/Ic50181A029 |
0.543 |
|
| 1978 |
Rietz RR, Zalkin A, Templeton DH, Edelstein NM, Templeton LK. Preparation and molecular and crystal structures of uranium(IV) borohydride-dimethyl ether and uranium (IV) borohydride-diethyl ether Inorganic Chemistry. 17: 653-658. DOI: 10.1021/Ic50181A028 |
0.376 |
|
| 1978 |
Andersen RA, Templeton DH, Zalkin A. Synthesis And Crystal Structure Of A Neodymium Isopropoxide Chloride, Nd6(Och(Ch3)2)17Cl Cheminform. 9. DOI: 10.1002/Chin.197841250 |
0.447 |
|
| 1978 |
ZALKIN A, WARD DL, BIAGIONI RN, TEMPLETON DH, BARTLETT N. ChemInform Abstract: CRYSTAL STRUCTURE OF FLUOROXENON(1+) HEXAFLUOROARSENATE(1-) Chemischer Informationsdienst. 9. DOI: 10.1002/chin.197831009 |
0.463 |
|
| 1978 |
Zalkin A, Ward DL, Biagioni RN, Templeton DH, Bartlett N. Crystal structure of XeF+AsF6 - Inorganic Chemistry. 17: 1318-1322. |
0.467 |
|
| 1978 |
Andersen RA, Templeton DH, Zalkin A. Synthesis and crystal structure of a neodymium isopropoxide chloride, Nd6[OCH(CH3)2]17Cl Inorganic Chemistry. 17: 1962-1965. |
0.342 |
|
| 1977 |
Reynolds JG, Zalkin A, Templeton DH. Structure of uranyl nitrate-bis(tetrahydrofuran) Inorganic Chemistry. 16: 3357-3359. DOI: 10.1021/Ic50178A078 |
0.382 |
|
| 1977 |
Reynolds JG, Zalkin A, Templeton DH, Edelstein NM. Crystal structure of tetrakis[bis(N,N′-dimethylethylenediamido)uranium(IV)], a tetrameric globular complex Inorganic Chemistry. 16: 1858-1861. DOI: 10.1021/Ic50174A006 |
0.397 |
|
| 1977 |
Reynolds JG, Zalkin A, Templeton DH, Edelstein NM. Syntheses and crystal structures of tetrakis(diphenylamido)uranium(IV) and bis(μ-oxo-tris(diphenylamido)uranium(IV)lithium diethyl etherate) Inorganic Chemistry. 16: 1090-1096. DOI: 10.1021/Ic50171A024 |
0.535 |
|
| 1977 |
Reynolds JG, Zalkin A, Templeton DH, Edelstein NM. Synthesis, crystal structure, and optical and magnetic properties of tris[bis(N,N′-dimethylethylenediamido)uranium(IV)], a trimeric complex Inorganic Chemistry. 16: 599-603. DOI: 10.1021/Ic50169A020 |
0.409 |
|
| 1977 |
Templeton LK, Templeton DH, Seppelt K, Bartlett N. Crystal and molecular structure of xenon bis(oxopentafluoroselenate(VI)), Xe(OSeF5)2 Cheminform. 8. DOI: 10.1002/Chin.197704003 |
0.536 |
|
| 1976 |
Templeton LK, Templeton DH, Walker R. Molecular structure and disorder in crystals of octaphenyluranocene, U[C8H4(C6H5)4] 2 Inorganic Chemistry. 15: 3000-3003. DOI: 10.1021/Ic50166A011 |
0.367 |
|
| 1976 |
Cheetham AK, Puddephatt RJ, Zalkin A, Templeton DH, Templeton LK. Crystal and molecular structure of diiodo(butane-1,4-diyl)bis(dimethylphenylphosphine)platinum(IV) Inorganic Chemistry. 15: 2997-2999. DOI: 10.1021/Ic50166A010 |
0.366 |
|
| 1976 |
Templeton LK, Templeton DH, Bartlett N, Seppelt K. Crystal and molecular structure of uranium hexakis(oxopentafluorotellurate), U(OTeF5)6 Inorganic Chemistry. 15: 2720-2722. DOI: 10.1021/Ic50165A029 |
0.358 |
|
| 1976 |
Templeton LK, Templeton DH, Seppelt K, Bartlett N. Crystal and molecular structure of xenon bis(oxopentafluoroselenate(VI)), Xe(OSeF5)2 Inorganic Chemistry. 15: 2718-2720. DOI: 10.1021/Ic50165A028 |
0.367 |
|
| 1976 |
Reynolds JG, Zalkin A, Templeton DH, Edelstein NM, Templeton LK. Crystal structure and optical and magnetic properties of tetrakis(diethylamido)uranium(IV), a five-coordinate dimeric complex in the solid state Inorganic Chemistry. 15: 2498-2502. DOI: 10.1021/Ic50164A036 |
0.338 |
|
| 1976 |
Templeton LK, Templeton DH, Zalkin A. Crystal structure of monoclinic sulfur Inorganic Chemistry. 15: 1999-2001. DOI: 10.1021/Ic50162A059 |
0.554 |
|
| 1976 |
Volz K, Zalkin A, Templeton DH. Crystal and molecular structures of thorium and uranium tetrakis(hexafluoroacetonylpyrazolide) complexes Inorganic Chemistry. 15: 1827-1831. DOI: 10.1021/Ic50162A019 |
0.369 |
|
| 1975 |
Jurnak FA, Templeton DH. The crystal structure and absolute configuration of a bromohexaacetyl derivative of vitexin Acta Crystallographica Section B Structural Crystallography and Crystal Chemistry. 31: 1304-1309. DOI: 10.1107/S0567740875005109 |
0.454 |
|
| 1975 |
Chapuis G, Zalkin A, Templeton DH. Crystal structure of ammonium hydrogen malonate The Journal of Chemical Physics. 62: 4919-4922. DOI: 10.1063/1.430405 |
0.352 |
|
| 1975 |
Bushweller CH, Bhat G, Letendre LJ, Brunelle JA, Bilofsky HS, Ruben H, Templeton DH, Zalkin A. Conformational analysis in multisulfur heterocycles. VIII. 3,3:6,6-bis(tetramethylene)-s-tetrathiane and 3,3:6,6-bis(pentamethylene)-s-tetrathiane. Slow s-tetrathiane chair-to-twist, chair-to-chair, and twist-to-twist interconversions. X-ray crystallographic studies Journal of the American Chemical Society. 97: 65-73. DOI: 10.1021/Ja00834A013 |
0.308 |
|
| 1974 |
Quarles WG, Templeton DH, Zalkin A. The crystal and molecular structure of melatonin Acta Crystallographica Section B Structural Crystallography and Crystal Chemistry. 30: 99-103. DOI: 10.1107/S0567740874002287 |
0.531 |
|
| 1974 |
Quarles WG, Templeton DH, Zalkin A. The crystal and molecular structure of 5-methoxytryptamine Acta Crystallographica Section B Structural Crystallography and Crystal Chemistry. 30: 95-98. DOI: 10.1107/S0567740874002275 |
0.542 |
|
| 1974 |
Megaw HD, Templeton DH. Crystal Structures: A Working Approach Physics Today. 27: 53-54. DOI: 10.1063/1.3128867 |
0.386 |
|
| 1974 |
Ruben H, Zalkin A, Faltens MO, Templeton DH. Crystal structure of sodium gold(I) thiosulfate dihydrate, Na3Au(S2O3)2·2H2O Inorganic Chemistry. 13: 1836-1839. DOI: 10.1021/Ic50138A011 |
0.538 |
|
| 1974 |
Bartlett N, DeBoer BG, Hollander FJ, Sladky FO, Templeton DH, Zalkin A. Crystal structures of [Xe2F3 +][AsF6 -] and [XeF5 +][AsF6 -] Inorganic Chemistry. 13: 780-785. |
0.467 |
|
| 1973 |
Ray S, Zalkin A, Templeton DH. Crystal structure of copper fluosilicate hexahydrate Acta Crystallographica Section B Structural Crystallography and Crystal Chemistry. 29: 2748-2751. DOI: 10.1107/S0567740873007491 |
0.512 |
|
| 1973 |
Ray S, Zalkin A, Templeton DH. Crystal structures of the fluosilicate hexahydrates of cobalt, nickel and zinc Acta Crystallographica Section B Structural Crystallography and Crystal Chemistry. 29: 2741-2747. DOI: 10.1107/S056774087300748X |
0.538 |
|
| 1973 |
Hollander FJ, Templeton DH, Zalkin A. The crystal and molecular structure of 1,3-diphenyl-1,3-propanedione enol Acta Crystallographica Section B Structural Crystallography and Crystal Chemistry. 29: 1552-1553. DOI: 10.1107/S0567740873004954 |
0.546 |
|
| 1973 |
Hollander FJ, Templeton DH, Zalkin A. Investigations of alkaline-earth β-diketone complexes. III. The crystal and molecular structure of bis(1,3-diphenyl-1,3-propanedionato)strontium hemiacetonate Acta Crystallographica Section B Structural Crystallography and Crystal Chemistry. 29: 1303-1308. DOI: 10.1107/S0567740873004425 |
0.462 |
|
| 1973 |
Hollander FJ, Templeton DH, Zalkin A. Investigations of alkaline-earth β-diketone complexes. II. The crystal and molecular structure of bis(l,3-diphenyl-1,3-propanedionato)calcium hemiethanolate Acta Crystallographica Section B Structural Crystallography and Crystal Chemistry. 29: 1295-1303. DOI: 10.1107/S0567740873004413 |
0.416 |
|
| 1973 |
Hollander FJ, Templeton DH, Zalkin A. Investigations of alkaline-earth β-diketone complexes. I. The crystal and molecular structure of bis(dimethylformamido)bis(1,3-diphenyl-1,3-propanedionato)magnesium Acta Crystallographica Section B Structural Crystallography and Crystal Chemistry. 29: 1289-1295. DOI: 10.1107/S0567740873004401 |
0.463 |
|
| 1973 |
Templeton LK, Templeton DH, Zalkin A. The crystal and molecular structure of 2-(N-nitrosomethylamino)acetamide Acta Crystallographica Section B Structural Crystallography and Crystal Chemistry. 29: 50-54. DOI: 10.1107/S0567740873001962 |
0.41 |
|
| 1973 |
Hollander FJ, Templeton DH, Zalkin A. Crystal and molecular structure of triphenylmethylphosphonium 1,1,1-tricarbonyl-4,6-dicarba-1-mangana-closo-nonaborate(1-) Inorganic Chemistry. 12: 2262-2266. DOI: 10.1021/Ic50128A010 |
0.543 |
|
| 1973 |
Zalkin A, Templeton DH, Ueki T. Crystal structure of l-tris(1,10-phenathroline)iron(II) bis(antimony(III) d-tartrate) octahydrate Inorganic Chemistry. 12: 1641-1646. DOI: 10.1021/Ic50125A033 |
0.399 |
|
| 1973 |
LEARY K, TEMPLETON DH, ZALKIN A, BARTLETT N. ChemInform Abstract: CRYSTAL STRUCTURE OF (XEF5(+))2(PDF6(2-)) Chemischer Informationsdienst. 4: no-no. DOI: 10.1002/chin.197339015 |
0.462 |
|
| 1973 |
Leary K, Templeton DH, Zalkin A, Bartlett N. Crystal structure of [XeF5 +]2[PdF6 2-] Inorganic Chemistry. 12: 1726-1730. |
0.465 |
|
| 1972 |
Fischer MS, Templeton DH, Zalkin A, Calvin M. Crystal and molecular structure of methyl pheophorbide with applications to the chlorophyll arrangement in photosynthetic lamellae Journal of the American Chemical Society. 94: 3613-3619. DOI: 10.1021/Ja00765A059 |
0.482 |
|
| 1972 |
Clair DS, Zalkin A, Templeton DH. The crystal structure of tetraethylammonium 2,2′-commo-bis(nonahydrodicarba-2-cobalta-closo-decaborate), a salt of the cobalt derivative of the nonahydridodicarbanonaborate(2-) ligand Inorganic Chemistry. 11: 377-381. DOI: 10.1021/Ic50108A035 |
0.491 |
|
| 1971 |
Templeton LK, Templeton DH. The crystal structure of POBr3: space group and refinement by least squares Acta Crystallographica Section B Structural Crystallography and Crystal Chemistry. 27: 1678-1679. DOI: 10.1107/S0567740871004564 |
0.37 |
|
| 1971 |
Fischer MS, Templeton DH, Zalkin A, Calvin M. Structure and chemistry of the porphyrins. The crystal and molecular structure of the monohydrated dipyridinated magnesium phthalocyanin complex Journal of the American Chemical Society. 93: 2622-2628. DOI: 10.1021/Ja00740A008 |
0.524 |
|
| 1971 |
Clair DS, Zalkin A, Templeton DH. The crystal structure of cesium 3,3′-commo-bis[nonahydro-1,2-dimethyl-1,2-dicarba-3-chroma-closo- dodecaborate] hydrate, a hydrate of a chromium metallocarborane salt Inorganic Chemistry. 10: 2587-2591. DOI: 10.1021/Ic50105A043 |
0.543 |
|
| 1971 |
Zalkin A, Sime RJ, Dodge RP, Templeton DH. Crystal structure of tris(2-aminoethyl)aminochlorozinc(II) tetraphenylborate Inorganic Chemistry. 10: 537-541. DOI: 10.1021/Ic50097A020 |
0.512 |
|
| 1971 |
Sime RJ, Dodge RP, Zalkin A, Templeton DH. The crystal structure of tris(2-aminoethyl)aminochlorozinc(II) tetraphenylborate Inorganic Chemistry. 10: 537-541. |
0.421 |
|
| 1970 |
Fischer MS, Templeton DH, Zalkin A. Solid state structure and chemistry of the choline halides and their analogues. Redetermination of the betaine hydrochloride structure, ((CH3)3NCH2COOH)+Cl-. Acta Crystallographica. Section B: Structural Crystallography and Crystal Chemistry. 26: 1392-7. PMID 5537159 DOI: 10.1107/S0567740870004211 |
0.345 |
|
| 1970 |
Clair DS, Zalkin A, Templeton DH. The crystal structure of 3,3′-commo-bis[undecahydro-1,2-dicarba-3-nickela-closo-dodecaborane], a nickel(IV) complex of the dicarbollide ion Journal of the American Chemical Society. 92: 1173-1179. DOI: 10.1021/Ja00708A010 |
0.474 |
|
| 1969 |
Drew MGB, Templeton DH, Zalkin A. The crystal and molecular structure of cembrene Acta Crystallographica Section B Structural Crystallography and Crystal Chemistry. 25: 261-267. DOI: 10.1107/S0567740869002093 |
0.542 |
|
| 1969 |
Zalkin A, Templeton DH, Karraker DG. Crystal and molecular structure of the heptacoordinate complex tris(diphenylpropanedionato)aquoholmium, Ho(PhCOCHCOPh)3.H2o Inorganic Chemistry. 8: 2680-2684. DOI: 10.1021/Ic50082A029 |
0.505 |
|
| 1969 |
Hopkins TE, Zalkin A, Templeton DH, Adamson MG. The crystal and molecular structure of hexaaquoaluminum hexachlororuthenate tetrahydrate Inorganic Chemistry. 8: 2421-2425. DOI: 10.1021/Ic50081A034 |
0.542 |
|
| 1969 |
Clair DS, Zalkin A, Templeton DH. Crystal structure of Cs2(B9C2H11)Co(B8C2H10)Co(B9C2H11).H2O, a salt of a three-icosahedral-fragment metallocarborane Inorganic Chemistry. 8: 2080-2086. DOI: 10.1021/Ic50080A010 |
0.529 |
|
| 1969 |
Spiro TG, Templeton DH, Zalkin A. Crystal structure of a hexanuclear basic lead(II) perchlorate hydrate: Pb6O(OH)6(ClO4)4.H2O Inorganic Chemistry. 8: 856-861. DOI: 10.1021/Ic50074A031 |
0.511 |
|
| 1969 |
DeBoer BG, Zalkin A, Templeton DH. Crystal and molecular structure of phosphorus trifluoride- tris(difluoroboryl)borane, B4F6-PF3 Inorganic Chemistry. 8: 836-841. DOI: 10.1021/Ic50074A028 |
0.546 |
|
| 1969 |
Zalkin A, Templeton DH, Karraker DG. The crystal and molecular structure of the heptacoordinate complex tris(diphenylpropanedionato)aquoholmium, Ho(C6H5COCHCOC6H5) 3·H2O Inorganic Chemistry. 8: 2680-2684. |
0.43 |
|
| 1969 |
St. Clair D, Zalkin A, Templeton DH. The crystal structure of Cs2(B9C2H11)Co(B8C 2H10)Co(B9C2H 11)·H2O, a salt of a three-icosahedral-fragment metallocarborane Inorganic Chemistry. 8: 2080-2086. |
0.397 |
|
| 1969 |
Spiro TG, Templeton DH, Zalkin A. The crystal structure of a hexanuclear basic lead(II) perchlorate hydrate: Pb6O(OH)6(ClO4)4 · H2O Inorganic Chemistry. 8: 856-861. |
0.414 |
|
| 1969 |
DeBoer BG, Zalkin A, Templeton DH. The crystal and molecular structure of phosphorus trifluoride-tris(difluoroboryl)borane, B4F6 · PF3 Inorganic Chemistry. 8: 836-841. |
0.449 |
|
| 1968 |
Palmer KJ, Templeton DH. Crystal and molecular structure of 1-bromotriptycene BrC20H13 Acta Crystallographica Section B Structural Crystallography and Crystal Chemistry. 24: 1048-1052. DOI: 10.1107/S0567740868003687 |
0.456 |
|
| 1968 |
Hardgrove GL, Templeton LK, Templeton DH. Crystal and molecular structures of three dihalobenzocyclobutenes Journal of Physical Chemistry. 72: 668-676. DOI: 10.1021/J100848A048 |
0.542 |
|
| 1968 |
Taylor RP, Templeton DH, Zalkin A, Horrocks WD. The crystal and molecular structure of tetraphenylarsonium triiodo(triphenylphosphine)nickelate(II), [(C6H5)4As][Ni(C6H5) 3PI3] Inorganic Chemistry. 7: 2629-2636. DOI: 10.1021/Ic50070A034 |
0.367 |
|
| 1968 |
Drew MGB, Templeton DH, Zalkin A. Crystal structure of .mu.-chloro-bis(chlorotetra(benzimidazole)nickel(II)) chloride-4-acetone Inorganic Chemistry. 7: 2618-2624. DOI: 10.1021/Ic50070A032 |
0.511 |
|
| 1968 |
Horrocks WDW, Templeton DH, Zalkin A. The crystal and molecular structure of tetra-n-butylammonium tribromo(quinoline)nickelate(II), [(n-C4H9)4N] [Ni(C9H7N)Br3] Inorganic Chemistry. 7: 2303-2311. DOI: 10.1021/Ic50069A026 |
0.382 |
|
| 1968 |
DeBoer BG, Zalkin A, Templeton DH. Crystal structure of a brominated carborane-metal sandwich compound, N(CH3)4[(B9C2H8Br3)2Co] Inorganic Chemistry. 7: 2288-2294. DOI: 10.1021/Ic50069A023 |
0.395 |
|
| 1968 |
Spiro TG, Templeton DH, Zalkin A. Crystal structure of trimethylplatinum hydroxide Inorganic Chemistry. 7: 2165-2167. DOI: 10.1021/Ic50068A045 |
0.551 |
|
| 1968 |
Horrocks WD, Templeton DH, Zalkin A. Crystal and molecular structure of bis(2,4-pentanedionato)bis(pyridine N-oxide)nickel(II), Ni(C5H7O2)2 (C5H5NO)2 Inorganic Chemistry. 7: 1552-1557. DOI: 10.1021/Ic50066A015 |
0.452 |
|
| 1968 |
Deboer BG, Zalkin A, Templeton DH. The crystal structure of the rubidium salt of an octadecahydroeicosaborate(2-) photoisomer Inorganic Chemistry. 7: 1085-1090. DOI: 10.1021/Ic50064A008 |
0.548 |
|
| 1968 |
Drew MGB, Templeton DH, Zalkin A. The crystal structure of μ-chloro-bis(chlorotetra(benzimidazole)nickel(II)) chloride-4-acetone Inorganic Chemistry. 7: 2618-2624. |
0.42 |
|
| 1968 |
Horrocks WD, Templeton DH, Zalkin A. The crystal and molecular structure of bis(2,4-pentanedionato)bis(pyridine N-oxide)nickel(II), Ni(C5H7O2)2(C5H 5NO)2 Inorganic Chemistry. 7: 1552-1557. |
0.321 |
|
| 1968 |
Spiro TG, Templeton DH, Zalkin A. The crystal structure of trimethylplatinum hydroxide Inorganic Chemistry. 7: 2165-2167. |
0.468 |
|
| 1967 |
Vogt, Jr L, Zalkin A, Templeton D. Correction. The Crystal and Molecular Structure of Phthalocyanatopyridinemanganese(III)-μ-oxo-phthalocyanantopyridinemanganese(III) Dipyridinate Inorganic Chemistry. 6: 2274-2274. DOI: 10.1021/Ic50058A611 |
0.512 |
|
| 1967 |
Zalkin A, Templeton D, Hopkins T. Correction. The Atomic Parameters in the Lanthanum Trifluoride Structure Inorganic Chemistry. 6: 2273-2273. DOI: 10.1021/Ic50058A605 |
0.319 |
|
| 1967 |
Zalkin A, Hopkins TE, Templeton DH. Crystal structure of Cs(B9C2H11)2Co Inorganic Chemistry. 6: 1911-1915. DOI: 10.1021/Ic50056A033 |
0.481 |
|
| 1967 |
Drew MGB, Templeton DH, Zalkin A. The crystal and molecular structure of sulfur nitride-boron trifluoride Inorganic Chemistry. 6: 1906-1910. DOI: 10.1021/Ic50056A032 |
0.542 |
|
| 1967 |
Vogt LH, Zalkin A, Templeton DH. The crystal and molecular structure of phthalocyanatopyridine-manganese(III)-μ-oxo- phthalocyanatopyridinemanganese(III) dipyridinate Inorganic Chemistry. 6: 1725-1730. DOI: 10.1021/Ic50055A025 |
0.515 |
|
| 1967 |
Zalkin A, Hopkins TE, Templeton DH. The crystal structure of Cs(B9C2H11)2Co Inorganic Chemistry. 6: 1911-1915. |
0.383 |
|
| 1966 |
Vogt LH, Zalkin A, Templeton DH. Crystal and molecular structure of a double complex of manganese with phthalocyanato and pyridine ligands. Science (New York, N.Y.). 151: 569-70. PMID 17809495 DOI: 10.1126/Science.151.3710.569 |
0.411 |
|
| 1966 |
Zalkin A, Forrester JD, Templeton DH. Ferrichrome-A tetrahydrate. Determination of crystal and molecular structure. Journal of the American Chemical Society. 88: 1810-4. PMID 5942990 DOI: 10.1021/Ja00960A040 |
0.539 |
|
| 1966 |
Ueki T, Zalkin A, Templeton DH. Crystal structure of thorium nitrate pentahydrate by X-ray diffraction Acta Crystallographica. 20: 836-841. DOI: 10.1107/S0365110X66001944 |
0.459 |
|
| 1966 |
Zalkin A, Hopkins TE, Templeton DH. The crystal structure of chlorothiodiazyl chloride, S3N2Cl2 Inorganic Chemistry. 5: 1767-1770. DOI: 10.1021/Ic50044A028 |
0.552 |
|
| 1966 |
Zalkin A, Templeton DH, Hopkins TE. The atomic parameters in the lanthanum trifluoride structure Inorganic Chemistry. 5: 1466-1468. DOI: 10.1021/Ic50042A047 |
0.323 |
|
| 1966 |
Hopkins TE, Zalkin A, Templeton DH, Adamson MG. The crystal structure of cesium aquopentachlororuthenate Inorganic Chemistry. 5: 1431-1433. DOI: 10.1021/Ic50042A033 |
0.55 |
|
| 1966 |
Hopkins TE, Zalkin A, Templeton DH, Adamson MG. The crystal and molecular structure of tetraphenylarsonium cis-diaquotetrachlororuthenate monohydrate Inorganic Chemistry. 5: 1427-1431. DOI: 10.1021/Ic50042A032 |
0.482 |
|
| 1966 |
Zalkin A, Hopkins TE, Templeton DH. The crystal structure of (B9C2H11)Re(CO)3Cs Inorganic Chemistry. 5: 1189-1193. DOI: 10.1021/Ic50041A025 |
0.506 |
|
| 1966 |
Templeton DH. Crystals: Perfect and Imperfect (Bennett, Allan) Journal of Chemical Education. 43: 563. DOI: 10.1021/ed043p563.1 |
0.388 |
|
| 1965 |
Ueki T, Zalkin A, Templeton DH. The crystal structure of osmium tetroxide Acta Crystallographica. 19: 157-160. DOI: 10.1107/S0365110X65003006 |
0.549 |
|
| 1965 |
Zalkin A, Templeton DH, Hopkins TE. The Crystal and Molecular Structure of C5H5FeB9C2H11 Journal of the American Chemical Society. 87: 3988-3990. DOI: 10.1021/Ja01095A041 |
0.542 |
|
| 1965 |
Templeton DH. Crystals: Their Role in Nature and in Science (Bunn, Charles) Journal of Chemical Education. 42: A550. DOI: 10.1021/ed042pA550 |
0.319 |
|
| 1965 |
Zalkin A, Templeton DH, Hopkins TE. The crystal and molecular structure of C5H6FeB9C2H11 [6] Journal of the American Chemical Society. 87: 3988-3990. |
0.456 |
|
| 1964 |
Zalkin A, Forrester JD, Templeton DH. Crystal and Molecular Structure of Ferrichrome A. Science (New York, N.Y.). 146: 261-3. PMID 17743711 DOI: 10.1126/Science.146.3641.261 |
0.411 |
|
| 1964 |
Zalkin A, Forrester JD, Templeton DH. The crystal structure of sodium fluorosilicate Acta Crystallographica. 17: 1408-1412. DOI: 10.1107/S0365110X64003516 |
0.548 |
|
| 1964 |
Templeton LK, Templeton DH, Zalkin A. Refinement of the crystal structure of mercuric sulfate monohydrate Acta Crystallographica. 17: 933-936. DOI: 10.1107/S0365110X64002444 |
0.552 |
|
| 1964 |
Zalkin A, Ruben H, Templeton DH. The crystal structure and hydrogen bonding of magnesium sulfate hexahydrate Acta Crystallographica. 17: 235-240. DOI: 10.1107/S0365110X64000603 |
0.441 |
|
| 1964 |
Zalkin A, Templeton DH. X-ray diffraction refinement of the calcium tungstate structure The Journal of Chemical Physics. 40: 501-504. DOI: 10.1063/1.1725143 |
0.41 |
|
| 1964 |
Forrester JD, Zalkin A, Templeton DH. The crystal and molecular structure of tetra-n-butylammoniumcopper(III) bis(maleonitrile dithiolate) and the geometry of the monovalent copper(III) bis(maleonitrile dithiolate) ion Inorganic Chemistry. 3: 1507-1515. DOI: 10.1021/Ic50021A008 |
0.462 |
|
| 1964 |
Forrester JD, Zalkin A, Templeton DH. The crystal and molecular structure of Di(tetra-n-butylammonium)cobalt(II) bis(maleonitrile dithiolate) and the geometry of the divalent cobalt(II) bis(maleonitrile dithiolate) ion Inorganic Chemistry. 3: 1500-1506. DOI: 10.1021/Ic50021A007 |
0.43 |
|
| 1964 |
Zalkin A, Forrester JD, Templeton DH. The crystal structure of sodium perxenate hexahydrate Inorganic Chemistry. 3: 1417-1421. DOI: 10.1021/Ic50020A016 |
0.548 |
|
| 1964 |
Zalkin A, Forrester JD, Templeton DH. The crystal structure of thorium tetraiodide Inorganic Chemistry. 3: 639-644. DOI: 10.1021/Ic50015A007 |
0.55 |
|
| 1964 |
Zalkin A, Forrester JD, Templeton DH. The crystal structure of manganese dichloride tetrahydrate Inorganic Chemistry. 3: 529-533. DOI: 10.1021/Ic50014A017 |
0.553 |
|
| 1964 |
Forrester JD, Zalkin A, Templeton DH, Wallmann JC. Crystal structure of terbium trichloride Inorganic Chemistry. 3: 185-188. DOI: 10.1021/Ic50012A007 |
0.55 |
|
| 1964 |
Forrester JD, Zalkin A, Templeton DH. Crystal and molecular structure of indium(III) iodide (In2I6) Inorganic Chemistry. 3: 63-67. DOI: 10.1021/Ic50011A013 |
0.543 |
|
| 1963 |
Zalkin A, Forrester JD, Templeton DH, Williamson SM, Koch CW. Sodium Perxenate Hexahydrate. Science (New York, N.Y.). 142: 501-2. PMID 17748166 DOI: 10.1126/Science.142.3591.501 |
0.383 |
|
| 1963 |
Templeton DH, Zalkin A. Crystal structure of europium tungstate Acta Crystallographica. 16: 762-766. DOI: 10.1107/S0365110X63001985 |
0.55 |
|
| 1963 |
Forrester JD, Senko ME, Zalkin A, Templeton D. Crystal structure of KH2F3and geometry of the H2F3−ion Acta Crystallographica. 16: 58-62. DOI: 10.1107/S0365110X63000098 |
0.553 |
|
| 1963 |
Zalkin A, Forrester JD, Templeton DH. Crystal structure of cerium magnesium nitrate hydrate The Journal of Chemical Physics. 39: 2881-2891. DOI: 10.1063/1.1734120 |
0.354 |
|
| 1963 |
Templeton DH, Zalkin A, Forrester JD, Williamson SM. Crystal and Molecular Structure of Xenon Trioxide Journal of the American Chemical Society. 85: 817-817. DOI: 10.1021/Ja00889A037 |
0.542 |
|
| 1963 |
Templeton DH, Zalkin A, Forrester JD, Williamson SM. Crystal and Molecular Structure of Xenon Tetrafluoride Journal of the American Chemical Society. 85: 242-242. DOI: 10.1021/Ja00885A038 |
0.542 |
|
| 1963 |
Templeton DH, Zalkin A, Forrester JD, Williamson SM. Crystal and molecular structure of xenon tetrafluoride [15] Journal of the American Chemical Society. 85: 242. |
0.457 |
|
| 1963 |
Templeton DH, Zalkin A, Forrester JD, Williamson SM. Crystal and molecular structure of xenon trioxide [5] Journal of the American Chemical Society. 85: 817. |
0.456 |
|
| 1962 |
Strieter FJ, Templeton DH. Crystal structure of butyric acid Acta Crystallographica. 15: 1240-1244. DOI: 10.1107/S0365110X6200328X |
0.389 |
|
| 1962 |
Strieter FJ, Templeton DH, Scheuerman RF, Sass RL. The crystal structure of propionic acid Acta Crystallographica. 15: 1233-1239. DOI: 10.1107/S0365110X62003278 |
0.396 |
|
| 1962 |
Zalkin A, Ruben H, Templeton DH. The crystal structure of cobalt sulfate hexahydrate Acta Crystallographica. 15: 1219-1224. DOI: 10.1107/S0365110X62003242 |
0.555 |
|
| 1962 |
Zalkin A, Lee K, Templeton DH. Crystal Structure of CsMnF3 The Journal of Chemical Physics. 37: 697-699. DOI: 10.1063/1.1733149 |
0.412 |
|
| 1962 |
Strieter FJ, Templeton DH. Crystal structure of the carbon tetrabromide p-xylene complex The Journal of Chemical Physics. 37: 161-164. DOI: 10.1063/1.1732942 |
0.382 |
|
| 1962 |
Margulis TN, Templeton DH. Crystal and Molecular Structure of Triethylscarphane The Journal of Chemical Physics. 36: 2311-2316. DOI: 10.1063/1.1732881 |
0.415 |
|
| 1961 |
Dodge RP, Templeton DH, Zalkin A. Crystal structure of vanadyl bisacetylacetonate. Geometry of vanadium in fivefold coordination The Journal of Chemical Physics. 35: 55-67. DOI: 10.1063/1.1731933 |
0.404 |
|
| 1961 |
Johnson QC, Templeton DH. Madelung constants for several structures The Journal of Chemical Physics. 34: 2004-2007. DOI: 10.1063/1.1731810 |
0.351 |
|
| 1961 |
Margulis TN, Templeton DH. Crystal And Molecular Structure Of The Compound Of Triethylphosphine And Carbon Disulfide1 Journal of the American Chemical Society. 83: 995-996. DOI: 10.1021/Ja01465A057 |
0.46 |
|
| 1961 |
Ruben HW, Templeton DH, Rosenstein RD, Olovsson I. Crystal structure and entropy of sodium sulfate decahydrate Journal of the American Chemical Society. 83: 820-824. DOI: 10.1021/Ja01465A019 |
0.544 |
|
| 1961 |
Margulis TN, Templeton DH. Crystal and molecular structure of the compound of triethylphosphine and carbon disulfide [2] Journal of the American Chemical Society. 83: 995-996. |
0.359 |
|
| 1960 |
Aronsson B, Templeton DH, Rundqvist S, Varde E, Westin G. A Note on the Compositions and Crystal Structures of MnB2, Mn3Si, Mn5Si3, and FeSi2. Acta Chemica Scandinavica. 14: 1414-1418. DOI: 10.3891/acta.chem.scand.14-1414 |
0.413 |
|
| 1960 |
Olovsson I, Templeton DH, Rundqvist S, Varde E, Westin G. The Crystal Structure of Hydrogen Peroxide Dihydrate. Acta Chemica Scandinavica. 14: 1325-1332. DOI: 10.3891/Acta.Chem.Scand.14-1325 |
0.493 |
|
| 1960 |
Andersson S, Templeton DH, Rundqvist S, Varde E, Westin G. The Crystal Structure of Ti5O9. Acta Chemica Scandinavica. 14: 1161-1172. DOI: 10.3891/acta.chem.scand.14-1161 |
0.41 |
|
| 1959 |
Olovsson I, Templeton DH. X-ray study of solid ammonia Acta Crystallographica. 12: 832-836. DOI: 10.1107/S0365110X59002420 |
0.339 |
|
| 1959 |
Olovsson I, Templeton DH. The crystal structure of ammonia monohydrate Acta Crystallographica. 12: 827-832. DOI: 10.1107/S0365110X59002419 |
0.442 |
|
| 1959 |
Hardgrove GL, Templeton DH. The crystal structure of ruthenocene Acta Crystallographica. 12: 28-32. DOI: 10.1107/S0365110X59000081 |
0.463 |
|
| 1958 |
Senko ME, Templeton DH. Crystal structure of 3-hydrazino-5-thiol-1,2,4-triazole Acta Crystallographica. 11: 808-812. DOI: 10.1107/S0365110X58002267 |
0.468 |
|
| 1958 |
Jones RE, Templeton DH. The crystal structure of acetic acid Acta Crystallographica. 11: 484-487. DOI: 10.1107/S0365110X58001341 |
0.388 |
|
| 1958 |
Clark ES, Templeton DH, MacGillavry CH. The crystal structure of gold(III) chloride Acta Crystallographica. 11: 284-288. DOI: 10.1107/S0365110X58000694 |
0.453 |
|
| 1956 |
Zalkin A, Templeton DH. The crystal structure of sodium amide Journal of Physical Chemistry. 60: 821-823. DOI: 10.1021/J150540A042 |
0.551 |
|
| 1956 |
Dauben CH, Templeton DH, Myers CE. The crystal structure of Cr5Si3 Journal of Physical Chemistry. 60: 443-445. DOI: 10.1021/J150538A015 |
0.549 |
|
| 1956 |
Zalkin A, Ramsey WJ, Templeton DH. Intermetallic compounds between lithium and lead. II. The crystal structure of Li8Pb3 Journal of Physical Chemistry. 60: 1275-1277. |
0.387 |
|
| 1955 |
Jones RE, Templeton DH. The crystal structure of indium (I) iodide Acta Crystallographica. 8: 847-847. DOI: 10.1107/S0365110X55002594 |
0.55 |
|
| 1955 |
Templeton DH. X-ray dispersion effects in crystal-structure determinations Acta Crystallographica. 8: 842-842. DOI: 10.1107/S0365110X5500251X |
0.451 |
|
| 1954 |
Siemons WJ, Templeton DH. The crystal structure of ammonium oxide Acta Crystallographica. 7: 194-198. DOI: 10.1107/S0365110X54000539 |
0.379 |
|
| 1954 |
Templeton DH. Lattice Parameters of Some Rare Earth Compounds and a Set of Crystal Radii Journal of the American Chemical Society. 76: 5237-5239. DOI: 10.1021/Ja01649A087 |
0.399 |
|
| 1954 |
Templeton DH, Carter GF. The crystal structure of yttrium trichloride and similar compounds Journal of Physical Chemistry. 58: 940-944. |
0.406 |
|
| 1953 |
Carter GF, Templeton DH. The crystal structure of high cyclobutane Acta Crystallographica. 6: 805-805. DOI: 10.1107/S0365110X53002295 |
0.45 |
|
| 1953 |
Templeton DH, Dauben CH. Crystal Structures of Rare Earth Oxychlorides Journal of the American Chemical Society. 75: 6069-6070. DOI: 10.1021/Ja01119A535 |
0.535 |
|
| 1953 |
Templeton DH, Dauben CH. Crystal structures of americium compounds Journal of the American Chemical Society. 75: 4560-4562. DOI: 10.1021/Ja01114A051 |
0.499 |
|
| 1953 |
Zalkin A, Templeton DH. The crystal structures of YF3 and related compounds Journal of the American Chemical Society. 75: 2453-2458. DOI: 10.1021/ja01106a052 |
0.392 |
|
| 1952 |
Templeton DH, Dauben CH. The Crystal Structures of NpC and Pu2O3 Lawrence Berkeley National Laboratory. DOI: 10.2172/877343 |
0.364 |
|
| 1951 |
Templeton DH, Dauben CH. The crystal structure of potassium bromo-rhenate(IV) Journal of the American Chemical Society. 73: 4492-4493. DOI: 10.1021/Ja01153A542 |
0.553 |
|
| 1950 |
Zalkin A, Templeton DH. The Crystal Structures of CeB4, ThB4, and UB4 Journal of Chemical Physics. 18: 391. DOI: 10.1107/S0365110X53000764 |
0.461 |
|
| 1950 |
Templeton DH, Dauben CH. The crystal structure of Mo3Si Acta Crystallographica. 3: 261-262. DOI: 10.1107/S0365110X50000689 |
0.464 |
|
| 1950 |
Zalkin A, Templeton DH. The crystal structures of CeB4, ThB4, and UB 4 The Journal of Chemical Physics. 18: 391. DOI: 10.1063/1.1747637 |
0.549 |
|
| 1950 |
Templeton DH, Dauben CH. The crystal structure of sodium superoxide Journal of the American Chemical Society. 72: 2251-2254. DOI: 10.1021/Ja01161A103 |
0.545 |
|
| 1947 |
Templeton DH, Howland JJ, Perlman I. Artificial radioactive isotopes of bismuth and lead Physical Review. 72: 766-771. DOI: 10.1103/Physrev.72.766 |
0.433 |
|
| 1947 |
Perlman I, Goeckermann RH, Templeton DH, Howland JJ. Fission of bismuth, lead, thallium, platinum, and tantalum with high energy particles [13] Physical Review. 72: 352. DOI: 10.1103/Physrev.72.352 |
0.421 |
|
| 1947 |
Howland JJ, Templeton DH, Perlman I. Artificial radioactive isotopes of polonium, bismuth and lead [4] Physical Review. 71: 552. DOI: 10.1103/Physrev.71.552 |
0.433 |
|
| Show low-probability matches. |
